CAS 1187931-17-4 appears in our catalog under these names: (R)–1–(2–Bromophenyl)ethanamine hydrochloride, (1R)-1-(2-Bromophenyl)ethan-1-amine hydrochloride, (R)-1-(2-Bromophenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(2-Bromophenyl)ethanamine hydrochloride, 98%, (R)-1-(2-Bromophenyl)ethanamine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
(1R)-1-(2-bromophenyl)ethanamine;hydrochloride (CAS 1187931-17-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(2-bromophenyl)ethanamine;hydrochloride. InChIKey: MPTGUFFHOKLEFK-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(2-bromophenyl)ethanamine;hydrochloride |
| InChIKey | MPTGUFFHOKLEFK-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)