cas: 1168139-41-0 — see every product listed under this CAS number, including other names
(R)-1-(3-Fluorophenyl)propan-1-amine hydrochloride, 95+% (CAS 1168139-41-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A301618-250mg |
| cas | 1168139-41-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 3709.09 Pln | |
| AmBeed | 5g | 27405.49 Pln | |
| AmBeed | 1g | 9125.41 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride (CAS 1168139-41-0) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: ODZRCWFYKMOLKD-SBSPUUFOSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | ODZRCWFYKMOLKD-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)