CAS 1168139-41-0 appears in our catalog under these names: (R)-1-(3-Fluorophenyl)propan-1-amine hydrochloride, 95%, (R)-1-(3-Fluorophenyl)propan-1-amine hydrochloride, 95+%, (R)–1–(3–FLUOROPHENYL)PROPAN–1–AMINE–HCl, (R)-1-(3-Fluorophenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
(1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride (CAS 1168139-41-0) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: ODZRCWFYKMOLKD-SBSPUUFOSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(3-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | ODZRCWFYKMOLKD-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)