cas: 103476-80-8 — see every product listed under this CAS number, including other names
(R)-1-Acetylindoline-2-carboxylic acid 95% (CAS 103476-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407509-100mg |
| cas | 103476-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A407509 |
(2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid (CAS 103476-80-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid. InChIKey: OGMIMMRKTFZDKW-SNVBAGLBSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | OGMIMMRKTFZDKW-SNVBAGLBSA-N |
| SMILES | CC(=O)N1[C@H](CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)