CAS 82950-72-9 appears in our catalog under these names: (S)-1-Acetyl-2,3-dihydro-1h-indole-2-carboxylic acid, 95%, (S)-1-Acetylindoline-2-carboxylic acid, 97%, (2S)-1-Acetyl-2,3-dihydro-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 2,5g.
(2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid (CAS 82950-72-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid. InChIKey: OGMIMMRKTFZDKW-JTQLQIEISA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | OGMIMMRKTFZDKW-JTQLQIEISA-N |
| SMILES | CC(=O)N1[C@@H](CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)