CAS 82923-75-9 appears in our catalog under these names: N-Acetylindoline-2-carboxylic acid, 96%, 1-Acetylindoline-2-carboxylic acid 97%, 1-Acetylindoline-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
1-acetyl-2,3-dihydroindole-2-carboxylic acid (CAS 82923-75-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-acetyl-2,3-dihydroindole-2-carboxylic acid. InChIKey: OGMIMMRKTFZDKW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-acetyl-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | OGMIMMRKTFZDKW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)