CAS 103476-80-8 appears in our catalog under these names: (2R)-1-Acetyl-2,3-dihydro-1h-indole-2-carboxylic acid, 95%, (2R)-1-Acetyl-2,3-dihydro-1H-indole-2-carboxylic acid, (R)-1-Acetylindoline-2-carboxylic acid 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 2,5g.
(2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid (CAS 103476-80-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid. InChIKey: OGMIMMRKTFZDKW-SNVBAGLBSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2R)-1-acetyl-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | OGMIMMRKTFZDKW-SNVBAGLBSA-N |
| SMILES | CC(=O)N1[C@H](CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)