cas: 287107-87-3 — see every product listed under this CAS number, including other names
(R)-1-BOC-2-(3-ETHOXY-3-OXOPROPANOYL)PYRROLIDINE, 98% (CAS 287107-87-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387864-250MG |
| cas | 287107-87-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3106.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate (CAS 287107-87-3) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl 2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate. InChIKey: SHPVYSDLQWCDJP-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl 2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate |
| InChIKey | SHPVYSDLQWCDJP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)