CAS 1098652-11-9 appears in our catalog under these names: (R)-N-Boc-4-oxo-l-proline tert-butyl ester, 95%, Di-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate, 95+%, (R)-N-BOC-4-OXO-L-PROLINE TERT-BUTYL ESTER, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100g.
Ditert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 1098652-11-9) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: ditert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: MPNWQUWKRDADHK-SNVBAGLBSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | ditert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | MPNWQUWKRDADHK-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC(=O)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)