Products 98977-38-9

CAS 98977-38-9 is the registry number for 1-tert-Butyl 4-ethyl 3-oxoazepane-1,4-dicarboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl 3-oxoazepane-1,4-dicarboxylate (CAS 98977-38-9) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 3-oxoazepane-1,4-dicarboxylate. InChIKey: STZNGLKBJPCWIB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO5
Molecular weight285.34 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 3-oxoazepane-1,4-dicarboxylate
InChIKeySTZNGLKBJPCWIB-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCCN(CC1=O)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)