cas: 1212176-33-4 — see every product listed under this CAS number, including other names
(R)-1-Boc-4-oxopiperidine-2-carboxylic acid, 98%, 98% (CAS 1212176-33-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143EM-100mg |
| cas | 1212176-33-4 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2541.20 Pln | |
| Chemat | 100g | 4470.80 Pln | |
| Chemat | 250g | 5958.80 Pln | |
| Chemat | 500g | 11198.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid (CAS 1212176-33-4) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid. InChIKey: GPBCBXYUAJQMQM-MRVPVSSYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid |
| InChIKey | GPBCBXYUAJQMQM-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)