cas: 620601-77-6 — see every product listed under this CAS number, including other names
(R)-1-Cbz-2-Cyanopyrrolidine 97% (CAS 620601-77-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340805-250mg |
| cas | 620601-77-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 542.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A340805 |
Benzyl (2R)-2-cyanopyrrolidine-1-carboxylate (CAS 620601-77-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: benzyl (2R)-2-cyanopyrrolidine-1-carboxylate. InChIKey: AUVGQGIWVNDVSL-GFCCVEGCSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzyl (2R)-2-cyanopyrrolidine-1-carboxylate |
| InChIKey | AUVGQGIWVNDVSL-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)