CAS 312531-87-6 appears in our catalog under these names: 4-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 98%, 4-(3,5-Dimethyl-pyrazol-1-ylmethyl)-benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
4-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 312531-87-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 4-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: ORMOJZFLVSEQOR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
| InChIKey | ORMOJZFLVSEQOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)