CAS 886588-61-0 appears in our catalog under these names: (R)-2-(Piperidin-3-yl)isoindoline-1,3-dione, 95%, (R)-2-(Piperidin-3-yl)isoindoline-1,3-dione hydrochloride, 95%, 2-(3R)-3-Piperidinyl-1H-isoindole-1,3(2H)-dione, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg.
2-[(3R)-piperidin-3-yl]isoindole-1,3-dione (CAS 886588-61-0) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 2-[(3R)-piperidin-3-yl]isoindole-1,3-dione. InChIKey: POAZMSVKCTYEPJ-SECBINFHSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-[(3R)-piperidin-3-yl]isoindole-1,3-dione |
| InChIKey | POAZMSVKCTYEPJ-SECBINFHSA-N |
| SMILES | C1C[C@H](CNC1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)