Products 116344-18-4

CAS 116344-18-4 is the registry number for 5-Isopropyl-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-phenyl-5-propan-2-ylpyrazole-4-carboxylic acid (CAS 116344-18-4) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 1-phenyl-5-propan-2-ylpyrazole-4-carboxylic acid. InChIKey: MQUOHNQYSXJILW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O2
Molecular weight230.26 g/mol
IUPAC name1-phenyl-5-propan-2-ylpyrazole-4-carboxylic acid
InChIKeyMQUOHNQYSXJILW-UHFFFAOYSA-N
SMILESCC(C)C1=C(C=NN1C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)