CAS 376359-05-6 is the registry number for 3-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 376359-05-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: WWFUQDPIXVPKQB-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
| InChIKey | WWFUQDPIXVPKQB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)