Products 376359-05-6

CAS 376359-05-6 appears in our catalog under these names: 3-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 95%, 3-(3,5-Dimethyl-pyrazol-1-ylmethyl)-benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 376359-05-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: WWFUQDPIXVPKQB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O2
Molecular weight230.26 g/mol
IUPAC name3-[(3,5-dimethylpyrazol-1-yl)methyl]benzoic acid
InChIKeyWWFUQDPIXVPKQB-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC2=CC(=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)