cas: 934423-10-6 — see every product listed under this CAS number, including other names
(R)-1-tert-butyl 3-methyl piperidine-1,3-dicarboxylate, 98%, 98% (CAS 934423-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GULA-100mg |
| cas | 934423-10-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 25g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate (CAS 934423-10-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate. InChIKey: LYYJQMCPEHXOEW-SECBINFHSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate |
| InChIKey | LYYJQMCPEHXOEW-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)OC |
Computed by PubChem (NCBI)