cas: 934423-10-6 — see every product listed under this CAS number, including other names
1-(tert-Butyl) 3-methyl (R)-piperidine-1,3-dicarboxylate 98% (CAS 934423-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A851899-100mg |
| cas | 934423-10-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A851899 |
1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate (CAS 934423-10-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate. InChIKey: LYYJQMCPEHXOEW-SECBINFHSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-piperidine-1,3-dicarboxylate |
| InChIKey | LYYJQMCPEHXOEW-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)OC |
Computed by PubChem (NCBI)