CAS 256935-69-0 appears in our catalog under these names: 3–(((9H–Fluoren–9–ylmethoxy)carbonyl)amino)–4–methoxybenzoic acid, Fomc-3-amino-4-methoxybenzoic acid, Fmoc-3-amino-4-methoxy-benzoic acid 97%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methoxybenzoic acid, 97%, 97%, Fmoc-3-amino-4-methoxy-benzoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybenzoic acid (CAS 256935-69-0) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybenzoic acid. InChIKey: RHASRZZYFQOPAC-UHFFFAOYSA-N.
| Molecular formula | C23H19NO5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybenzoic acid |
| InChIKey | RHASRZZYFQOPAC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)