Products 879500-54-6

CAS 879500-54-6 is the registry number for Fmoc-DL-4-Hydroxyphenylglycine. Offered by: Creative Peptides. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 879500-54-6) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: QBYSEGZHOGZXFO-UHFFFAOYSA-N.

Identity
Molecular formulaC23H19NO5
Molecular weight389.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid
InChIKeyQBYSEGZHOGZXFO-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC=C(C=C4)O)C(=O)O

Computed by PubChem (NCBI)