CAS 14325-35-0 is the registry number for N,O-Dibenzoyl-L-tyrosine (>90%). Offered by: TRC. Available pack sizes: 10g, 1g.
(2S)-2-benzamido-3-(4-benzoyloxyphenyl)propanoic acid (CAS 14325-35-0) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: (2S)-2-benzamido-3-(4-benzoyloxyphenyl)propanoic acid. InChIKey: UMTSYXVWHRVSQY-FQEVSTJZSA-N.
| Molecular formula | C23H19NO5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2S)-2-benzamido-3-(4-benzoyloxyphenyl)propanoic acid |
| InChIKey | UMTSYXVWHRVSQY-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)OC(=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)