CAS 433292-11-6 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-2-(3-hydroxyphenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(3-hydroxyphenyl)acetic acid (CAS 433292-11-6) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(3-hydroxyphenyl)acetic acid. InChIKey: JAVDQXYAZCMANV-UHFFFAOYSA-N.
| Molecular formula | C23H19NO5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(3-hydroxyphenyl)acetic acid |
| InChIKey | JAVDQXYAZCMANV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC(=CC=C4)O)C(=O)O |
Computed by PubChem (NCBI)