cas: 21752-35-2 — see every product listed under this CAS number, including other names
(R)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 97% (CAS 21752-35-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235520-1G |
| cas | 21752-35-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2028.47 Pln | |
| Fluorochem | 25g | 6932.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid (CAS 21752-35-2) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid. InChIKey: VCFKXWGKKDZMPO-LLVKDONJSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid |
| InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)