CAS 21752-36-3 appears in our catalog under these names: (S)–(–)–N–(α–Methylbenzyl)phthalamic Acid, (S)-(-)-N-(alpha-Methylbenzyl)phthalamic Acid, >98.0%(T), (S)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 98%, 98%, (S)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g.
2-[[(1S)-1-phenylethyl]carbamoyl]benzoic acid (CAS 21752-36-3) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[[(1S)-1-phenylethyl]carbamoyl]benzoic acid. InChIKey: VCFKXWGKKDZMPO-NSHDSACASA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[[(1S)-1-phenylethyl]carbamoyl]benzoic acid |
| InChIKey | VCFKXWGKKDZMPO-NSHDSACASA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)