cas: 2165947-34-0 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-2-(1-methyl-1H-pyrazol-4-yl)acetic acid, 97% (CAS 2165947-34-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 25g, 50g. Offered by: AmBeed, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A980720-5g |
| cas | 2165947-34-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14964.88 Pln | |
| AmBeed | 10g | 18089.68 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 500mg | 1130.00 Pln | |
| Chemat | 1g | 1648.40 Pln | |
| Chemat | 5g | 4816.40 Pln | |
| Chemat | 25g | 14306.00 Pln | |
| Chemat | 50g | 23387.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1-methylpyrazol-4-yl)acetic acid (CAS 2165947-34-0) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1-methylpyrazol-4-yl)acetic acid. InChIKey: NHJNTMKOTDIQMP-MRVPVSSYSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1-methylpyrazol-4-yl)acetic acid |
| InChIKey | NHJNTMKOTDIQMP-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CN(N=C1)C)C(=O)O |
Computed by PubChem (NCBI)