CAS 2065250-35-1 is the registry number for 5-Amino-pyrazole-1,4-dicarboxylic acid 1-tert-butyl ester 4-ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-O-tert-butyl 4-O-ethyl 5-aminopyrazole-1,4-dicarboxylate (CAS 2065250-35-1) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 5-aminopyrazole-1,4-dicarboxylate. InChIKey: XZROSVZUYRZDDX-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 5-aminopyrazole-1,4-dicarboxylate |
| InChIKey | XZROSVZUYRZDDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)