CAS 1692905-99-9 is the registry number for 3-((tert-Butoxycarbonyl)(methyl)amino)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazole-5-carboxylic acid (CAS 1692905-99-9) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: 1-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazole-5-carboxylic acid. InChIKey: RAIJRWAKLFSEMS-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazole-5-carboxylic acid |
| InChIKey | RAIJRWAKLFSEMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=NN(C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)