CAS 1211400-01-9 is the registry number for tert-Butyl (S)-1,3-dioxohexahydroimidazo[1,5-a]pyrazine-7(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate (CAS 1211400-01-9) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: tert-butyl 1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate. InChIKey: DBLHOCRPOWKYJA-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | tert-butyl 1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
| InChIKey | DBLHOCRPOWKYJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(C1)C(=O)NC2=O |
Computed by PubChem (NCBI)