CAS 50654-94-9 appears in our catalog under these names: NAlpha-Boc-D-histidine, Na-Boc-D-histidine, Boc–D–His–OH, Boc-D-His-OH, N(alpha)-Boc-D-histidine, 98+% . Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 10g, 2,5g, 5g, 25g, 1g, 250mg, 5 g.
(2R)-3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 50654-94-9) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: (2R)-3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AYMLQYFMYHISQO-MRVPVSSYSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (2R)-3-(1H-imidazol-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AYMLQYFMYHISQO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CN=CN1)C(=O)O |
Computed by PubChem (NCBI)