cas: 74562-03-1 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-2-(thiophen-2-yl)acetic acid, 95% (CAS 74562-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239185-100MG |
| cas | 74562-03-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1002.79 Pln | |
| Fluorochem | 1g | 3913.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid (CAS 74562-03-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid. InChIKey: CFAJOXPICRIMCA-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid |
| InChIKey | CFAJOXPICRIMCA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=CS1)C(=O)O |
Computed by PubChem (NCBI)