CAS 74562-03-1 appears in our catalog under these names: Boc-(r)-2-thienylglycine, 95%, Boc–(r)–2–thienylglycine, Boc-(2-Thienyl)-Gly-OH 98%, (R)-2-((tert-Butoxycarbonyl)amino)-2-(thiophen-2-yl)acetic acid, 98%, 98%, (R)-2-((tert-Butoxycarbonyl)amino)-2-(thiophen-2-yl)acetic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid (CAS 74562-03-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid. InChIKey: CFAJOXPICRIMCA-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid |
| InChIKey | CFAJOXPICRIMCA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=CS1)C(=O)O |
Computed by PubChem (NCBI)