CAS 459414-01-8 appears in our catalog under these names: 3-(3,4-Dimethyl-benzenesulfonylamino)-propionic acid, 95%, 3-(3,4-Dimethyl-benzenesulfonylamino)-propionicacid, 95%, 3-(3,4-Dimethylbenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
3-[(3,4-dimethylphenyl)sulfonylamino]propanoic acid (CAS 459414-01-8) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 3-[(3,4-dimethylphenyl)sulfonylamino]propanoic acid. InChIKey: IQVMYGSVWQCJFR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 3-[(3,4-dimethylphenyl)sulfonylamino]propanoic acid |
| InChIKey | IQVMYGSVWQCJFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCCC(=O)O)C |
Computed by PubChem (NCBI)