CAS 592472-92-9 appears in our catalog under these names: N-(2,3-Dimethylphenyl)-n-(methylsulfonyl)glycine, 95%, N-(2,3-Dimethylphenyl)-N-(methylsulfonyl)glycine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 500mg.
2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid (CAS 592472-92-9) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid. InChIKey: XDGKCDLOAWRWJU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid |
| InChIKey | XDGKCDLOAWRWJU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N(CC(=O)O)S(=O)(=O)C)C |
Computed by PubChem (NCBI)