CAS 40512-56-9 appears in our catalog under these names: Boc-(s)-2-thienylglycine, 95%, Boc–(S)–2–thienylglycine, Boc-(S)-2-thienylglycine, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2-(thiophen-2-yl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid (CAS 40512-56-9) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid. InChIKey: CFAJOXPICRIMCA-MRVPVSSYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid |
| InChIKey | CFAJOXPICRIMCA-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=CS1)C(=O)O |
Computed by PubChem (NCBI)