cas: 2350048-17-6 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-5,5-difluorohexanoic acid, 97% (CAS 2350048-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134PNM-100mg |
| cas | 2350048-17-6 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 933.20 Pln | |
| Chemat | 500mg | 1365.20 Pln | |
| Chemat | 1g | 2234.00 Pln | |
| Chemat | 5g | 6582.80 Pln | |
| Chemat | 10g | 11363.60 Pln | |
| Chemat | 25g | 17445.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 2350048-17-6) is a chemical compound with the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. IUPAC name: (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XUUGMBMDWZRWJV-SSDOTTSWSA-N.
| Molecular formula | C11H19F2NO4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XUUGMBMDWZRWJV-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(C)(F)F)C(=O)O |
Computed by PubChem (NCBI)