cas: 1445976-44-2 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 97% (CAS 1445976-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch112JTG-100mg |
| cas | 1445976-44-2 |
| size | 100mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 458.75 Pln | |
| BLDpharm | 5g | 1430.63 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| Fluorochem | 2.5g | 919.49 Pln | |
| Fluorochem | 5g | 1257.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1445976-44-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: PMBPWNBVQINJRH-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | PMBPWNBVQINJRH-SECBINFHSA-N |
| SMILES | CC(C)CC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)