CAS 132549-43-0 appears in our catalog under these names: Boc-l-beta-homoleucine, 95%, (S)–3–(tert–Butoxycarbonylamino)–5–methylhexanoic acid, Boc-L-beta-HLeu-OH, (S)-3-(Boc-amino)-5-methylhexanoic acid, 95% , Boc-L-beta-homoleucine. Offered by: Combi-blocks, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 250mg, 1g, 5g, 50g, 100mg, 10g, 25g, 100g.
(3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 132549-43-0) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XRVAMBSTOWHUMM-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XRVAMBSTOWHUMM-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)