CAS 208522-10-5 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 95%, (S)–2–((tert–Butoxycarbonyl)amino)–5–methylhexanoic acid, (S)-2-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 97%, Boc-HoLeu-OH, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg, 2.5g.
(2S)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 208522-10-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: PMBPWNBVQINJRH-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S)-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | PMBPWNBVQINJRH-VIFPVBQESA-N |
| SMILES | CC(C)CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)