(R)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, 95%
cas: 112245-04-2 — see every product listed under this CAS number, including other names
(R)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, 95% (CAS 112245-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F053848-100MG |
| cas | 112245-04-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 987.17 Pln | |
| Fluorochem | 2g | 1898.31 Pln | |
| Fluorochem | 5g | 4610.89 Pln | |
| Fluorochem | 10g | 8984.35 Pln | |
| Fluorochem | 25g | 19891.97 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1905.62 Pln | |
| Ambeed | 10g | 3735.69 Pln | |
| Ambeed | 25g | 8324.75 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 1600.40 Pln | |
| Chemat | 5g | 4677.20 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (CAS 112245-04-2) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: (2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid. InChIKey: NPIMKSLXCPUXPD-SECBINFHSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| InChIKey | NPIMKSLXCPUXPD-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, (2R)-2-[(tert-Butoxycarbonyl)methyl]-4-(methyl)pentanoic acid, (2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid, Butanedioic acid, 2-(2-methylpropyl)-, 4-(1,1-dimethylethyl) ester, (2R)-, (2R)-2-(2-tert-butoxy-2-oxo-ethyl)-4-methyl-pentanoic acid, (R)-2-[2-(tert-Butoxy)-2-oxoethyl]-4-methylpentanoic Acid, NPIMKSLXCPUXPD-SECBINFHSA-N, s10481, 4-tert-butyl hydrogen 2(R)-isobutylsuccinate, 4-tert.butyl hydrogen 2(R)-isobutylsuccinate