Products 157542-03-5
CAS 157542-03-5 appears in our catalog under these names: (S)-2-isobutylsuccinic acid 4-O-t-butyl ester, 98%, 98%, (S)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (CAS 157542-03-5) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid. InChIKey: NPIMKSLXCPUXPD-VIFPVBQESA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| InChIKey | NPIMKSLXCPUXPD-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)