CAS 112245-04-2 appears in our catalog under these names: (R)–2–(2–(tert–Butoxy)–2–oxoethyl)–4–methylpentanoic acid, (R)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, 95%, (R)-2-(2-(tert-Butoxy)-2-oxoethyl)-4-methylpentanoic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2g, 5g, 10g, 25g.
(2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (CAS 112245-04-2) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: (2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid. InChIKey: NPIMKSLXCPUXPD-SECBINFHSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (2R)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| InChIKey | NPIMKSLXCPUXPD-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)