cas: 446292-07-5 — see every product listed under this CAS number, including other names
(R)-2-(2-Hydroxy-3-((4-(3-oxomorpholino)phenyl)amino)propyl)isoindoline-1,3-dione, 97%, 97% (CAS 446292-07-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9GD-100mg |
| cas | 446292-07-5 |
| size | 100mg |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 650.00 Pln | |
| Chemat | 25g | 1197.20 Pln | |
| Chemat | 100g | 3784.40 Pln | |
| Chemat | 500g | 13185.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione (CAS 446292-07-5) is a chemical compound with the molecular formula C21H21N3O5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione. InChIKey: CKFVSMPWXAASIQ-MRXNPFEDSA-N.
| Molecular formula | C21H21N3O5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione |
| InChIKey | CKFVSMPWXAASIQ-MRXNPFEDSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@H](CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)