cas: 446292-07-5 — see every product listed under this CAS number, including other names
(R)-2-(2-Hydroxy-3-((4-(3-oxomorpholino)phenyl)amino)propyl)isoindoline-1,3-dione, 98% (CAS 446292-07-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234933-1G |
| cas | 446292-07-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1632.78 Pln | |
| Fluorochem | 50g | 3215.55 Pln | |
| Fluorochem | 100g | 4793.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione (CAS 446292-07-5) is a chemical compound with the molecular formula C21H21N3O5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione. InChIKey: CKFVSMPWXAASIQ-MRXNPFEDSA-N.
| Molecular formula | C21H21N3O5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione |
| InChIKey | CKFVSMPWXAASIQ-MRXNPFEDSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@H](CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)