cas: 446292-07-5 — see every product listed under this CAS number, including other names
(R)-2-(2-Hydroxy-3-((4-(3-oxomorpholino)phenyl)amino)propyl)isoindoline-1,3-dione, 99.69% (CAS 446292-07-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 g, 10 g, 250 mg, 1 g, 25 g, 500 mg, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-75975-5 g |
| cas | 446292-07-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 719.08 Pln | |
| MedChemExpress | 100 g | 5302.70 Pln | |
| MedChemExpress | 10 g | 1081.31 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 25 g | 2037.97 Pln | |
| MedChemExpress | 500 mg | 287.18 Pln | |
| MedChemExpress | 50 g | 3356.87 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.69% |
2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione (CAS 446292-07-5) is a chemical compound with the molecular formula C21H21N3O5 and a molecular weight of 395.4 g/mol. IUPAC name: 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione. InChIKey: CKFVSMPWXAASIQ-MRXNPFEDSA-N.
| Molecular formula | C21H21N3O5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione |
| InChIKey | CKFVSMPWXAASIQ-MRXNPFEDSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@H](CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)