cas: 306281-86-7 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(4-(trifluoromethyl)phenyl)ethanol, 95% (CAS 306281-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633757-100MG |
| cas | 306281-86-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1471.37 Pln | |
| Fluorochem | 250mg | 2174.25 Pln | |
| Fluorochem | 1g | 5324.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-2-[4-(trifluoromethyl)phenyl]ethanol (CAS 306281-86-7) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (2R)-2-amino-2-[4-(trifluoromethyl)phenyl]ethanol. InChIKey: VDJAPRZLEXCFHF-QMMMGPOBSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (2R)-2-amino-2-[4-(trifluoromethyl)phenyl]ethanol |
| InChIKey | VDJAPRZLEXCFHF-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)N)C(F)(F)F |
Computed by PubChem (NCBI)