CAS 2089388-97-4 appears in our catalog under these names: (R)-2-Amino-2-(6-chloropyridin-3-yl)ethanol dihydrochloride, 97%, 97%, (R)-2-Amino-2-(6-chloropyridin-3-yl)ethanol dihydrochloride, 95%, (R)–2–Amino–2–(6–chloropyridin–3–yl)ethanol dihydrochloride, (R)-2-Amino-2-(6-chloropyridin-3-yl)ethanol dihydrochloride, 97%. Offered by: Chemat, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;dihydrochloride (CAS 2089388-97-4) is a chemical compound with the molecular formula C7H11Cl3N2O and a molecular weight of 245.5 g/mol. IUPAC name: (2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;dihydrochloride. InChIKey: AVUNDUCVDXJOFX-ILKKLZGPSA-N.
| Molecular formula | C7H11Cl3N2O |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | (2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;dihydrochloride |
| InChIKey | AVUNDUCVDXJOFX-ILKKLZGPSA-N |
| SMILES | C1=CC(=NC=C1[C@H](CO)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)