cas: 400626-71-3 — see every product listed under this CAS number, including other names
(R)-2-Benzyl 1-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate, 95%, 95% (CAS 400626-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKQL-100mg |
| cas | 400626-71-3 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 731.60 Pln | |
| Chemat | 25g | 1562.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 400626-71-3) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: TZNBTMCEMLXYEM-CYBMUJFWSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | TZNBTMCEMLXYEM-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)