cas: 400626-71-3 — see every product listed under this CAS number, including other names
Avibactam impurity 1, 99.77% (CAS 400626-71-3) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Z0501-10 g |
| cas | 400626-71-3 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 370.78 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 310.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.77% |
2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 400626-71-3) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: TZNBTMCEMLXYEM-CYBMUJFWSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | TZNBTMCEMLXYEM-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)