cas: 42990-55-6 — see every product listed under this CAS number, including other names
(R)-2-Bromo-3-phenylpropionicacid, 97%, 97% (CAS 42990-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11818T-250mg |
| cas | 42990-55-6 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 664.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-bromo-3-phenylpropanoic acid (CAS 42990-55-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2R)-2-bromo-3-phenylpropanoic acid. InChIKey: WDRSCFNERFONKU-MRVPVSSYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2R)-2-bromo-3-phenylpropanoic acid |
| InChIKey | WDRSCFNERFONKU-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)Br |
Computed by PubChem (NCBI)