CAS 16503-53-0 appears in our catalog under these names: 2–Bromo–3–phenylpropanoic acid, 2-Bromo-3-phenylpropanoic acid, 95%, 95%, 2-Bromo-3-phenylpropanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
2-bromo-3-phenylpropanoic acid (CAS 16503-53-0) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-bromo-3-phenylpropanoic acid. InChIKey: WDRSCFNERFONKU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-bromo-3-phenylpropanoic acid |
| InChIKey | WDRSCFNERFONKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)Br |
Computed by PubChem (NCBI)